Products 1427433-65-5
CAS 1427433-65-5 appears in our catalog under these names: 6–Bromo–4–fluoro–2–methyl–1，3–benzothiazole, 6-Bromo-4-fluoro-2-methyl-1,3-benzothiazole, 6-Bromo-4-fluoro-2-methyl-1,3-benzothiazole 95%, 6-Bromo-4-fluoro-2-methyl-1,3-benzothiazole, 95%, 95%, 6-Bromo-4-fluoro-2-methylbenzo[d]thiazole, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 5g, 250mg, 1g, 10g.
6-bromo-4-fluoro-2-methyl-1,3-benzothiazole (CAS 1427433-65-5) is a chemical compound with the molecular formula C8H5BrFNS and a molecular weight of 246.10 g/mol. IUPAC name: 6-bromo-4-fluoro-2-methyl-1,3-benzothiazole. InChIKey: BRJHPBPSYPUGCM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNS |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2-methyl-1,3-benzothiazole |
| InChIKey | BRJHPBPSYPUGCM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2S1)Br)F |
Computed by PubChem (NCBI)