CAS 1427440-12-7 is the registry number for Methyl 2-amino-7-fluorobenzo[d]thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-amino-7-fluoro-1,3-benzothiazole-4-carboxylate (CAS 1427440-12-7) is a chemical compound with the molecular formula C9H7FN2O2S and a molecular weight of 226.23 g/mol. IUPAC name: methyl 2-amino-7-fluoro-1,3-benzothiazole-4-carboxylate. InChIKey: VPNAKFWNZRZNIA-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2S |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | methyl 2-amino-7-fluoro-1,3-benzothiazole-4-carboxylate |
| InChIKey | VPNAKFWNZRZNIA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=C(C=C1)F)SC(=N2)N |
Computed by PubChem (NCBI)