Products 731001-99-3

CAS 731001-99-3 is the registry number for 5-[(2-Fluorophenoxy)methyl]-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-[(2-fluorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 731001-99-3) is a chemical compound with the molecular formula C9H7FN2O2S and a molecular weight of 226.23 g/mol. IUPAC name: 5-[(2-fluorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: GUBJWMWRDXXNGV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7FN2O2S
Molecular weight226.23 g/mol
IUPAC name5-[(2-fluorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione
InChIKeyGUBJWMWRDXXNGV-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OCC2=NNC(=S)O2)F

Computed by PubChem (NCBI)