CAS 731001-99-3 is the registry number for 5-[(2-Fluorophenoxy)methyl]-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-[(2-fluorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 731001-99-3) is a chemical compound with the molecular formula C9H7FN2O2S and a molecular weight of 226.23 g/mol. IUPAC name: 5-[(2-fluorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: GUBJWMWRDXXNGV-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2S |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 5-[(2-fluorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | GUBJWMWRDXXNGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=NNC(=S)O2)F |
Computed by PubChem (NCBI)