Products 1427445-29-1
CAS 1427445-29-1 is the registry number for Methyl 2-bromo-5-fluorobenzo[d]thiazole-7-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Methyl 2-bromo-5-fluoro-1,3-benzothiazole-7-carboxylate (CAS 1427445-29-1) is a chemical compound with the molecular formula C9H5BrFNO2S and a molecular weight of 290.11 g/mol. IUPAC name: methyl 2-bromo-5-fluoro-1,3-benzothiazole-7-carboxylate. InChIKey: DOSGONNWWRQJFL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2S |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | methyl 2-bromo-5-fluoro-1,3-benzothiazole-7-carboxylate |
| InChIKey | DOSGONNWWRQJFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)F)N=C(S2)Br |
Computed by PubChem (NCBI)