Products 3093570-71-6
CAS 3093570-71-6 is the registry number for Methyl 3-bromo-6-fluorothieno[3,2-b]pyridine-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-bromo-6-fluorothieno[3,2-b]pyridine-2-carboxylate (CAS 3093570-71-6) is a chemical compound with the molecular formula C9H5BrFNO2S and a molecular weight of 290.11 g/mol. IUPAC name: methyl 3-bromo-6-fluorothieno[3,2-b]pyridine-2-carboxylate. InChIKey: NUSPGTGUHIJYHV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2S |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | methyl 3-bromo-6-fluorothieno[3,2-b]pyridine-2-carboxylate |
| InChIKey | NUSPGTGUHIJYHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=C(C=N2)F)Br |
Computed by PubChem (NCBI)