Products 1427500-17-1

CAS 1427500-17-1 is the registry number for methyl 4-(3-bromo-2-hydroxyphenyl)butanoate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-(3-bromo-2-hydroxyphenyl)butanoate (CAS 1427500-17-1) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: methyl 4-(3-bromo-2-hydroxyphenyl)butanoate. InChIKey: IQFROUMJAPPBKE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BrO3
Molecular weight273.12 g/mol
IUPAC namemethyl 4-(3-bromo-2-hydroxyphenyl)butanoate
InChIKeyIQFROUMJAPPBKE-UHFFFAOYSA-N
SMILESCOC(=O)CCCC1=C(C(=CC=C1)Br)O

Computed by PubChem (NCBI)