CAS 142751-35-7 is the registry number for 2,4,6-Trimethylphenylglyoxal Hydrate. Offered by: TRC. Available pack sizes: 5g.
2-oxo-2-(2,4,6-trimethylphenyl)acetaldehyde;hydrate (CAS 142751-35-7) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-oxo-2-(2,4,6-trimethylphenyl)acetaldehyde;hydrate. InChIKey: SBIUCNOOFPPMNX-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-oxo-2-(2,4,6-trimethylphenyl)acetaldehyde;hydrate |
| InChIKey | SBIUCNOOFPPMNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C=O)C.O |
Computed by PubChem (NCBI)