Products 1427521-36-5

CAS 1427521-36-5 is the registry number for JWH 210 N–pentanoic acid metabolite. Offered by: GLPBio. Available pack sizes: 5mg, 1mg, 10mg.

Structural formula: {0} (CAS {1})

5-[3-(4-ethylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid (CAS 1427521-36-5) is a chemical compound with the molecular formula C26H25NO3 and a molecular weight of 399.5 g/mol. IUPAC name: 5-[3-(4-ethylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid. InChIKey: PKGSQKIUCYVUDF-UHFFFAOYSA-N.

Identity
Molecular formulaC26H25NO3
Molecular weight399.5 g/mol
IUPAC name5-[3-(4-ethylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid
InChIKeyPKGSQKIUCYVUDF-UHFFFAOYSA-N
SMILESCCC1=CC=C(C2=CC=CC=C12)C(=O)C3=CN(C4=CC=CC=C43)CCCCC(=O)O

Computed by PubChem (NCBI)