Products 1427537-92-5
CAS 1427537-92-5 is the registry number for ASK1-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5Z)-5-(furan-2-ylmethylidene)-3-pyridin-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1427537-92-5) is a chemical compound with the molecular formula C13H8N2O2S2 and a molecular weight of 288.3 g/mol. IUPAC name: (5Z)-5-(furan-2-ylmethylidene)-3-pyridin-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: FMAMMNRLZOOXEN-XFFZJAGNSA-N.
| Molecular formula | C13H8N2O2S2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | (5Z)-5-(furan-2-ylmethylidene)-3-pyridin-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | FMAMMNRLZOOXEN-XFFZJAGNSA-N |
| SMILES | C1=CC(=CN=C1)N2C(=O)/C(=C/C3=CC=CO3)/SC2=S |
Computed by PubChem (NCBI)