CAS 19822-35-6 appears in our catalog under these names: (4-Isothiocyanatophenyl)(4-nitrophenyl)sulfane, 97%, 4-Isothiocyanato-4'-nitrodiphenyl sulfide. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g.
1-isothiocyanato-4-(4-nitrophenyl)sulfanylbenzene (CAS 19822-35-6) is a chemical compound with the molecular formula C13H8N2O2S2 and a molecular weight of 288.3 g/mol. IUPAC name: 1-isothiocyanato-4-(4-nitrophenyl)sulfanylbenzene. InChIKey: XQXCSNLNVVAJRO-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2S2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 1-isothiocyanato-4-(4-nitrophenyl)sulfanylbenzene |
| InChIKey | XQXCSNLNVVAJRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)SC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)