CAS 1428065-38-6 is the registry number for 3-Bromo-5-((3,3-difluoropyrrolidin-1-yl)methyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine (CAS 1428065-38-6) is a chemical compound with the molecular formula C10H11BrF2N2 and a molecular weight of 277.11 g/mol. IUPAC name: 3-bromo-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine. InChIKey: JQDWDQIPRYTKAZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2N2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 3-bromo-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine |
| InChIKey | JQDWDQIPRYTKAZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)CC2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)