Products 1936659-12-9
CAS 1936659-12-9 is the registry number for 5-Bromo-2-(3,3-difluoro-pyrrolidin-1-ylmethyl)-pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-2-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine (CAS 1936659-12-9) is a chemical compound with the molecular formula C10H11BrF2N2 and a molecular weight of 277.11 g/mol. IUPAC name: 5-bromo-2-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine. InChIKey: RFLPBSCNAWTYSC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2N2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 5-bromo-2-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine |
| InChIKey | RFLPBSCNAWTYSC-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)CC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)