CAS 14281-77-7 appears in our catalog under these names: Manganese bisglycinate, 95%, Manganese Bisglycinate, Manganese(II) 2-aminoacetate, 95+%, Manganese(II) 2–aminoacetate. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 500g, 100g, 1kg, 25g, on request, 0,5kg, 0,25kg.
Bis(2-aminoacetate);manganese(2+) (CAS 14281-77-7) is a chemical compound with the molecular formula C4H8MnN2O4 and a molecular weight of 203.06 g/mol. IUPAC name: bis(2-aminoacetate);manganese(2+). InChIKey: JNMKPXXKHWQWFB-UHFFFAOYSA-L.
| Molecular formula | C4H8MnN2O4 |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | bis(2-aminoacetate);manganese(2+) |
| InChIKey | JNMKPXXKHWQWFB-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])N.C(C(=O)[O-])N.[Mn+2] |
Computed by PubChem (NCBI)