CAS 6912-28-3 is the registry number for Dichlorobis(glycine) Manganese. Offered by: TRC. Available pack sizes: 5g.
Bis(2-aminoacetate);manganese(2+) (CAS 6912-28-3) is a chemical compound with the molecular formula C4H8MnN2O4 and a molecular weight of 203.06 g/mol. IUPAC name: bis(2-aminoacetate);manganese(2+). InChIKey: JNMKPXXKHWQWFB-UHFFFAOYSA-L.
| Molecular formula | C4H8MnN2O4 |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | bis(2-aminoacetate);manganese(2+) |
| InChIKey | JNMKPXXKHWQWFB-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])N.C(C(=O)[O-])N.[Mn+2] |
Computed by PubChem (NCBI)