CAS 1428198-37-1 appears in our catalog under these names: endo-6-(Trifluoromethyl)-3-azabicyclo(3.1.0)hexane hydrochloride, 98%, Endo-6-(trifluoromethyl)-3-azabicyclo(3.1.0)hexane hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
(1R,5S)-6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 1428198-37-1) is a chemical compound with the molecular formula C6H9ClF3N and a molecular weight of 187.59 g/mol. IUPAC name: (1R,5S)-6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: RJEVOPRUJWDKRJ-FLGDEJNQSA-N.
| Molecular formula | C6H9ClF3N |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | (1R,5S)-6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | RJEVOPRUJWDKRJ-FLGDEJNQSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C(F)(F)F)CN1.Cl |
Computed by PubChem (NCBI)