Products 1428341-65-4
CAS 1428341-65-4 is the registry number for LG308. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(8-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-phenylethanone (CAS 1428341-65-4) is a chemical compound with the molecular formula C19H17FN2O and a molecular weight of 308.3 g/mol. IUPAC name: 1-(8-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-phenylethanone. InChIKey: CGQLRSOQDATUAX-UHFFFAOYSA-N.
| Molecular formula | C19H17FN2O |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 1-(8-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-phenylethanone |
| InChIKey | CGQLRSOQDATUAX-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C3=C(N2)C(=CC=C3)F)C(=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)