Products 2748592-03-0
CAS 2748592-03-0 is the registry number for AZEFUBIM. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
Azetidin-1-yl-[1-[(4-fluorophenyl)methyl]indol-3-yl]methanone (CAS 2748592-03-0) is a chemical compound with the molecular formula C19H17FN2O and a molecular weight of 308.3 g/mol. IUPAC name: azetidin-1-yl-[1-[(4-fluorophenyl)methyl]indol-3-yl]methanone. InChIKey: NIRUFXPSGVSZBK-UHFFFAOYSA-N.
| Molecular formula | C19H17FN2O |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | azetidin-1-yl-[1-[(4-fluorophenyl)methyl]indol-3-yl]methanone |
| InChIKey | NIRUFXPSGVSZBK-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C(=O)C2=CN(C3=CC=CC=C32)CC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)