Products 1428441-56-8

CAS 1428441-56-8 is the registry number for Terbutaline Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-amine oxide (CAS 1428441-56-8) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: N-[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-amine oxide. InChIKey: GEFLKBLXGUQYEB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO4
Molecular weight241.28 g/mol
IUPAC nameN-[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-amine oxide
InChIKeyGEFLKBLXGUQYEB-UHFFFAOYSA-N
SMILESCC(C)(C)[NH+](CC(C1=CC(=CC(=C1)O)O)O)[O-]

Computed by PubChem (NCBI)