CAS 1428441-56-8 is the registry number for Terbutaline Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-amine oxide (CAS 1428441-56-8) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: N-[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-amine oxide. InChIKey: GEFLKBLXGUQYEB-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | N-[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-2-methylpropan-2-amine oxide |
| InChIKey | GEFLKBLXGUQYEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[NH+](CC(C1=CC(=CC(=C1)O)O)O)[O-] |
Computed by PubChem (NCBI)