CAS 1428532-52-8 appears in our catalog under these names: 5-Fluoro-2-(methylthio)phenylboronic acid pinacol ester, 95%, 2-(5-Fluoro-2-(methylthio)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 5-Fluoro-2-(methylthio)phenylboronic acid pinacol ester, ≥95%, ≥95%, 5-Fluoro-2-(methylthio)phenylboronic acid pinacol ester, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(5-fluoro-2-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1428532-52-8) is a chemical compound with the molecular formula C13H18BFO2S and a molecular weight of 268.2 g/mol. IUPAC name: 2-(5-fluoro-2-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZTEDPWHSFNMEOU-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2S |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 2-(5-fluoro-2-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZTEDPWHSFNMEOU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)SC |
Computed by PubChem (NCBI)