CAS 1436431-16-1 appears in our catalog under these names: 2-Fluoro-4-methylthiophenylboronic acid pinacol ester, 98%, 98%, 2-Fluoro-4-methylthiophenylboronic acid pinacol ester, 98%, 2-(2-Fluoro-4-(methylthio)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2-fluoro-4-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1436431-16-1) is a chemical compound with the molecular formula C13H18BFO2S and a molecular weight of 268.2 g/mol. IUPAC name: 2-(2-fluoro-4-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LZEUNWHRPJFBPN-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2S |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 2-(2-fluoro-4-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LZEUNWHRPJFBPN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)SC)F |
Computed by PubChem (NCBI)