CAS 1428532-90-4 appears in our catalog under these names: 8-Bromo-6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3(2h)-one, 95%, 1,2,4-Triazolo[4,3-a]pyridin-3(2H)-one, 8-bromo-6-methyl-, 97%, 97%, 8-BROMO-6-METHYL-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE, 98%, 8-Bromo-6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
8-bromo-6-methyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 1428532-90-4) is a chemical compound with the molecular formula C7H6BrN3O and a molecular weight of 228.05 g/mol. IUPAC name: 8-bromo-6-methyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: MLCZFBJAGPGWML-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | 8-bromo-6-methyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | MLCZFBJAGPGWML-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NNC2=O)C(=C1)Br |
Computed by PubChem (NCBI)