Products 142873-41-4
CAS 142873-41-4 appears in our catalog under these names: Lipid peroxidation inhibitor 1, Lipid peroxidation inhibitor 1. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, Get quote.
2,4,6,7-tetramethyl-2-[(4-phenylpiperidin-1-yl)methyl]-3H-1-benzofuran-5-amine (CAS 142873-41-4) is a chemical compound with the molecular formula C24H32N2O and a molecular weight of 364.5 g/mol. IUPAC name: 2,4,6,7-tetramethyl-2-[(4-phenylpiperidin-1-yl)methyl]-3H-1-benzofuran-5-amine. InChIKey: OFJJFTDZPRQPBY-UHFFFAOYSA-N.
| Molecular formula | C24H32N2O |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 2,4,6,7-tetramethyl-2-[(4-phenylpiperidin-1-yl)methyl]-3H-1-benzofuran-5-amine |
| InChIKey | OFJJFTDZPRQPBY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CC(O2)(C)CN3CCC(CC3)C4=CC=CC=C4)C(=C1N)C)C |
Computed by PubChem (NCBI)