CAS 2748625-09-2 is the registry number for Valeryl fentanyl–13C6 (CRM). Offered by: GLPBio. Available pack sizes: 100μg.
N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-[1-(2-phenylethyl)piperidin-4-yl]pentanamide (CAS 2748625-09-2) is a chemical compound with the molecular formula C24H32N2O and a molecular weight of 370.5 g/mol. IUPAC name: N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-[1-(2-phenylethyl)piperidin-4-yl]pentanamide. InChIKey: VCCPXHWAJYWQMR-RKCJWEPRSA-N.
| Molecular formula | C24H32N2O |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-[1-(2-phenylethyl)piperidin-4-yl]pentanamide |
| InChIKey | VCCPXHWAJYWQMR-RKCJWEPRSA-N |
| SMILES | CCCCC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)[13C]3=[13CH][13CH]=[13CH][13CH]=[13CH]3 |
Computed by PubChem (NCBI)