CAS 142885-88-9 appears in our catalog under these names: 2,3,5-Trimethyl-4-nitropyridine, 97%, Esomeprazole Impurity 59, Esomeprazole Impurity 54. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,3,5-trimethyl-4-nitropyridine (CAS 142885-88-9) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,3,5-trimethyl-4-nitropyridine. InChIKey: TVWVJGMOIPHMAV-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,3,5-trimethyl-4-nitropyridine |
| InChIKey | TVWVJGMOIPHMAV-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)