CAS 142885-91-4 is the registry number for Omeprazole Related Compound 14. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-6-methoxy-1H-benzimidazole (CAS 142885-91-4) is a chemical compound with the molecular formula C16H16N4O3S and a molecular weight of 344.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-6-methoxy-1H-benzimidazole. InChIKey: PYVDAEPDIQMNEV-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-6-methoxy-1H-benzimidazole |
| InChIKey | PYVDAEPDIQMNEV-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1[N+](=O)[O-])C)CSC2=NC3=C(N2)C=C(C=C3)OC |
Computed by PubChem (NCBI)