CAS 333759-74-3 is the registry number for 2,6-Diamino-4-(2,3,4-trimethoxyphenyl)-4h-thiopyran-3,5-dicarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,6-diamino-4-(2,3,4-trimethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile (CAS 333759-74-3) is a chemical compound with the molecular formula C16H16N4O3S and a molecular weight of 344.4 g/mol. IUPAC name: 2,6-diamino-4-(2,3,4-trimethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile. InChIKey: HHTYXPROEQKIEO-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2,6-diamino-4-(2,3,4-trimethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| InChIKey | HHTYXPROEQKIEO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C2C(=C(SC(=C2C#N)N)N)C#N)OC)OC |
Computed by PubChem (NCBI)