CAS 1428946-28-4 is the registry number for 5′-(1,1-Dimethylethyl)[1,1′:3′,1′′-terphenyl]-3,3′′-diol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[3-tert-butyl-5-(3-hydroxyphenyl)phenyl]phenol (CAS 1428946-28-4) is a chemical compound with the molecular formula C22H22O2 and a molecular weight of 318.4 g/mol. IUPAC name: 3-[3-tert-butyl-5-(3-hydroxyphenyl)phenyl]phenol. InChIKey: XMSDVIOVOOCERQ-UHFFFAOYSA-N.
| Molecular formula | C22H22O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3-[3-tert-butyl-5-(3-hydroxyphenyl)phenyl]phenol |
| InChIKey | XMSDVIOVOOCERQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C2=CC(=CC=C2)O)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)