Products 787618-40-0

CAS 787618-40-0 is the registry number for 2',6'-Dimethoxy-2,6-dimethyl-(1,1',2',1')terphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-[2-(2,6-dimethoxyphenyl)phenyl]-1,3-dimethylbenzene (CAS 787618-40-0) is a chemical compound with the molecular formula C22H22O2 and a molecular weight of 318.4 g/mol. IUPAC name: 2-[2-(2,6-dimethoxyphenyl)phenyl]-1,3-dimethylbenzene. InChIKey: XTPAERYQARYXEM-UHFFFAOYSA-N.

Identity
Molecular formulaC22H22O2
Molecular weight318.4 g/mol
IUPAC name2-[2-(2,6-dimethoxyphenyl)phenyl]-1,3-dimethylbenzene
InChIKeyXTPAERYQARYXEM-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)C2=CC=CC=C2C3=C(C=CC=C3OC)OC

Computed by PubChem (NCBI)