CAS 20263-26-7 appears in our catalog under these names: (R)-1-(Triphenylmethoxy)propan-2-ol, 95%, (R)-1-(Trityloxy)propan-2-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2R)-1-trityloxypropan-2-ol (CAS 20263-26-7) is a chemical compound with the molecular formula C22H22O2 and a molecular weight of 318.4 g/mol. IUPAC name: (2R)-1-trityloxypropan-2-ol. InChIKey: JODCGDLBQGFBTI-GOSISDBHSA-N.
| Molecular formula | C22H22O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (2R)-1-trityloxypropan-2-ol |
| InChIKey | JODCGDLBQGFBTI-GOSISDBHSA-N |
| SMILES | C[C@H](COC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)