CAS 1428956-08-4 is the registry number for 4-Chloro-7H,8H,9H-pyrimido(4,5-b)azepine-6-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxylic acid;hydrochloride (CAS 1428956-08-4) is a chemical compound with the molecular formula C9H9Cl2N3O2 and a molecular weight of 262.09 g/mol. IUPAC name: 4-chloro-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxylic acid;hydrochloride. InChIKey: SXLDDUPRUUBDBV-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3O2 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 4-chloro-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxylic acid;hydrochloride |
| InChIKey | SXLDDUPRUUBDBV-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=C1C(=O)O)C(=NC=N2)Cl.Cl |
Computed by PubChem (NCBI)