CAS 199658-79-2 appears in our catalog under these names: 2-(2,6-dichlorophenyl)-N-(N-hydroxycarbamimidoyl)acetamide, N-Hydroxy Guanfacine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-(2,6-dichlorophenyl)-N-(N'-hydroxycarbamimidoyl)acetamide (CAS 199658-79-2) is a chemical compound with the molecular formula C9H9Cl2N3O2 and a molecular weight of 262.09 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-N-(N'-hydroxycarbamimidoyl)acetamide. InChIKey: KTMCBAVXRFIKJC-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3O2 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-N-(N'-hydroxycarbamimidoyl)acetamide |
| InChIKey | KTMCBAVXRFIKJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)NC(=NO)N)Cl |
Computed by PubChem (NCBI)