Products 1429309-30-7
CAS 1429309-30-7 is the registry number for (1-(2-(Dimethylamino)pyridin-4-yl)-1h-pyrazol-4-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[1-[2-(dimethylamino)-4-pyridinyl]pyrazol-4-yl]methanol (CAS 1429309-30-7) is a chemical compound with the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. IUPAC name: [1-[2-(dimethylamino)-4-pyridinyl]pyrazol-4-yl]methanol. InChIKey: PYAFEQSIEHDJOM-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O |
|---|---|
| Molecular weight | 218.26 g/mol |
| IUPAC name | [1-[2-(dimethylamino)-4-pyridinyl]pyrazol-4-yl]methanol |
| InChIKey | PYAFEQSIEHDJOM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=CC(=C1)N2C=C(C=N2)CO |
Computed by PubChem (NCBI)