CAS 379254-21-4 appears in our catalog under these names: 1-Ethyl-2-methyl-1h-benzoimidazole-5-carboxylic acid hydrazide, 95%, 1-Ethyl-2-methyl-1H-1,3-benzodiazole-5-carbohydrazide, 95%, 1-Ethyl-2-methyl-1H-1,3-benzodiazole-5-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-ethyl-2-methylbenzimidazole-5-carbohydrazide (CAS 379254-21-4) is a chemical compound with the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. IUPAC name: 1-ethyl-2-methylbenzimidazole-5-carbohydrazide. InChIKey: VAXLBFJUHDUIRW-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O |
|---|---|
| Molecular weight | 218.26 g/mol |
| IUPAC name | 1-ethyl-2-methylbenzimidazole-5-carbohydrazide |
| InChIKey | VAXLBFJUHDUIRW-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=C1C=CC(=C2)C(=O)NN)C |
Computed by PubChem (NCBI)