CAS 142941-66-0 is the registry number for benzyl (2S,3S)-1-trityl-3-methyl-2-aziridinecarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S,3S)-3-methyl-1-tritylaziridine-2-carboxylate (CAS 142941-66-0) is a chemical compound with the molecular formula C30H27NO2 and a molecular weight of 433.5 g/mol. IUPAC name: benzyl (2S,3S)-3-methyl-1-tritylaziridine-2-carboxylate. InChIKey: MATRDGUUKSDIHC-VPZURYLOSA-N.
| Molecular formula | C30H27NO2 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | benzyl (2S,3S)-3-methyl-1-tritylaziridine-2-carboxylate |
| InChIKey | MATRDGUUKSDIHC-VPZURYLOSA-N |
| SMILES | C[C@H]1[C@H](N1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)