CAS 2956493-98-2 is the registry number for (3-(Hydroxy(phenyl)methyl)-1H-indol-2-yl)di-p-tolylmethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-bis(4-methylphenyl)methanol (CAS 2956493-98-2) is a chemical compound with the molecular formula C30H27NO2 and a molecular weight of 433.5 g/mol. IUPAC name: [3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-bis(4-methylphenyl)methanol. InChIKey: AJUBQNQIOAYWNV-UHFFFAOYSA-N.
| Molecular formula | C30H27NO2 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | [3-[hydroxy(phenyl)methyl]-1H-indol-2-yl]-bis(4-methylphenyl)methanol |
| InChIKey | AJUBQNQIOAYWNV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=C(C=C2)C)(C3=C(C4=CC=CC=C4N3)C(C5=CC=CC=C5)O)O |
Computed by PubChem (NCBI)