CAS 1429418-16-5 appears in our catalog under these names: 3-(3,5-Dimethylphenoxy)-1-methyl-1H-pyrazol-4-amine, 95%, 3-(3,5-Dimethylphenoxy)-1-methyl-1H-pyrazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(3,5-dimethylphenoxy)-1-methylpyrazol-4-amine (CAS 1429418-16-5) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 3-(3,5-dimethylphenoxy)-1-methylpyrazol-4-amine. InChIKey: RYZQOQLKTMSYAI-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 3-(3,5-dimethylphenoxy)-1-methylpyrazol-4-amine |
| InChIKey | RYZQOQLKTMSYAI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=NN(C=C2N)C)C |
Computed by PubChem (NCBI)