CAS 1429421-71-5 is the registry number for 6-{((tert-Butyldimethylsilyl)oxy)methyl}oxan-3-ol. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol (CAS 1429421-71-5) is a chemical compound with the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. IUPAC name: 6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol. InChIKey: ZSMXKOXSMIVAQR-UHFFFAOYSA-N.
| Molecular formula | C12H26O3Si |
|---|---|
| Molecular weight | 246.42 g/mol |
| IUPAC name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol |
| InChIKey | ZSMXKOXSMIVAQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC(CO1)O |
Computed by PubChem (NCBI)