CAS 361547-56-0 appears in our catalog under these names: Methyl 3-(tert-butyldimethylsilyloxy)-2,2-dimethylpropanoate, 95%, Methyl 3-((tert-Butyldimethylsilyl)oxy)-2,2-dimethylpropanoate, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropanoate (CAS 361547-56-0) is a chemical compound with the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. IUPAC name: methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropanoate. InChIKey: ZIYMGGHOKXREEH-UHFFFAOYSA-N.
| Molecular formula | C12H26O3Si |
|---|---|
| Molecular weight | 246.42 g/mol |
| IUPAC name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropanoate |
| InChIKey | ZIYMGGHOKXREEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C)(C)C(=O)OC |
Computed by PubChem (NCBI)