CAS 1429509-81-8 appears in our catalog under these names: (R)–Irsenontrine, (R)-Irsenontrine, 99%, 99%, (R)-Irsenontrine, 99.00%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10 mg, 5 mg, 100 mg, 25 mg, 50 mg.
7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-1-[(3R)-oxolan-3-yl]-5H-pyrazolo[4,5-c]quinolin-4-one (CAS 1429509-81-8) is a chemical compound with the molecular formula C22H22N4O3 and a molecular weight of 390.4 g/mol. IUPAC name: 7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-1-[(3R)-oxolan-3-yl]-5H-pyrazolo[4,5-c]quinolin-4-one. InChIKey: CKJDCNZBABIEBZ-OAHLLOKOSA-N.
| Molecular formula | C22H22N4O3 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-1-[(3R)-oxolan-3-yl]-5H-pyrazolo[4,5-c]quinolin-4-one |
| InChIKey | CKJDCNZBABIEBZ-OAHLLOKOSA-N |
| SMILES | CC1=CN=C(C(=C1C2=CC3=C(C=C2)C4=C(C=NN4[C@@H]5CCOC5)C(=O)N3)C)OC |
Computed by PubChem (NCBI)