Products 871837-61-5
CAS 871837-61-5 is the registry number for Antiproliferative agent-39. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indol-5-yl]-3,3-dimethylbutanamide (CAS 871837-61-5) is a chemical compound with the molecular formula C22H22N4O3 and a molecular weight of 390.4 g/mol. IUPAC name: N-[2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indol-5-yl]-3,3-dimethylbutanamide. InChIKey: LROQXUQPXGXPQZ-UHFFFAOYSA-N.
| Molecular formula | C22H22N4O3 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | N-[2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indol-5-yl]-3,3-dimethylbutanamide |
| InChIKey | LROQXUQPXGXPQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=CC2=C(C=C1)NC(=C2C3=C(C4=CC=CC=C4N3)N=O)O |
Computed by PubChem (NCBI)
Synonyms:
Antiproliferative agent-39, orb1941752