Products 1429636-72-5
CAS 1429636-72-5 appears in our catalog under these names: Doxofylline Impurity 4, Doxofylline Impurity 6, 7-(2,2-Dimethoxyethyl)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione (CAS 1429636-72-5) is a chemical compound with the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. IUPAC name: 7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: WUIMHDSPSQXXIW-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O4 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 7-(2,2-dimethoxyethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | WUIMHDSPSQXXIW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(OC)OC |
Computed by PubChem (NCBI)