CAS 24613-06-7 appears in our catalog under these names: (R)-Razoxane (Levrazoxane), Dexrazoxane Impurity 9, Dexrazoxane Impurity 6, Dexrazoxane Impurity 10, (R)-Levrazoxane. Offered by: Chemat Brand, Hubei YoungXin, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg, 10 mg.
4-[(2R)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione (CAS 24613-06-7) is a chemical compound with the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. IUPAC name: 4-[(2R)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione. InChIKey: BMKDZUISNHGIBY-SSDOTTSWSA-N.
| Molecular formula | C11H16N4O4 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 4-[(2R)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione |
| InChIKey | BMKDZUISNHGIBY-SSDOTTSWSA-N |
| SMILES | C[C@H](CN1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
Computed by PubChem (NCBI)