Products 1429664-95-8
CAS 1429664-95-8 is the registry number for 3，3'–(9，10–Anthracenediyldi–(1E)–2，1–ethenediyl)bis(pyridine). Offered by: GLPBio. Available pack sizes: 1g, 250mg.
3-[(E)-2-[10-[(E)-2-pyridin-3-ylethenyl]anthracen-9-yl]ethenyl]pyridine (CAS 1429664-95-8) is a chemical compound with the molecular formula C28H20N2 and a molecular weight of 384.5 g/mol. IUPAC name: 3-[(E)-2-[10-[(E)-2-pyridin-3-ylethenyl]anthracen-9-yl]ethenyl]pyridine. InChIKey: RIFGJAOTVLGZMA-WXUKJITCSA-N.
| Molecular formula | C28H20N2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 3-[(E)-2-[10-[(E)-2-pyridin-3-ylethenyl]anthracen-9-yl]ethenyl]pyridine |
| InChIKey | RIFGJAOTVLGZMA-WXUKJITCSA-N |
| SMILES | C1=CC=C2C(=C3C(=C(C2=C1)/C=C/C4=CN=CC=C4)C=CC=C3)/C=C/C5=CN=CC=C5 |
Computed by PubChem (NCBI)