CAS 1634668-57-7 is the registry number for 4,4'-(Pyrene-2,7-diyl)dianiline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[7-(4-aminophenyl)pyren-2-yl]aniline (CAS 1634668-57-7) is a chemical compound with the molecular formula C28H20N2 and a molecular weight of 384.5 g/mol. IUPAC name: 4-[7-(4-aminophenyl)pyren-2-yl]aniline. InChIKey: TXUDRTVFINLKFY-UHFFFAOYSA-N.
| Molecular formula | C28H20N2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 4-[7-(4-aminophenyl)pyren-2-yl]aniline |
| InChIKey | TXUDRTVFINLKFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C4C(=C2)C=CC5=CC(=CC(=C54)C=C3)C6=CC=C(C=C6)N)N |
Computed by PubChem (NCBI)