CAS 642-04-6 appears in our catalog under these names: 2,3,5,6-Tetraphenylpyrazine, >95% (HPLC), 2,3,5,6-Tetraphenylpyrazine 95%. Offered by: TRC, Ambeed. Available pack sizes: 250mg, 500mg, 50mg, 100mg, 1g, 5g.
2,3,5,6-tetraphenylpyrazine (CAS 642-04-6) is a chemical compound with the molecular formula C28H20N2 and a molecular weight of 384.5 g/mol. IUPAC name: 2,3,5,6-tetraphenylpyrazine. InChIKey: ZPKCJXWKXAHCSX-UHFFFAOYSA-N.
| Molecular formula | C28H20N2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 2,3,5,6-tetraphenylpyrazine |
| InChIKey | ZPKCJXWKXAHCSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C(=N2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)