CAS 1429782-21-7 appears in our catalog under these names: 4–Chloro–2,6–dimethylquinazoline, 4-Chloro-2,6-dimethylquinazoline 95%, 4-Chloro-2,6-dimethylquinazoline, 95%, 95%, 4-Chloro-2,6-dimethylquinazoline, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-chloro-2,6-dimethylquinazoline (CAS 1429782-21-7) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 4-chloro-2,6-dimethylquinazoline. InChIKey: JXJIMWVOELGXPO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 4-chloro-2,6-dimethylquinazoline |
| InChIKey | JXJIMWVOELGXPO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N=C2Cl)C |
Computed by PubChem (NCBI)