CAS 1429878-86-3 is the registry number for Montelukast Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate (CAS 1429878-86-3) is a chemical compound with the molecular formula C28H24ClNO3 and a molecular weight of 457.9 g/mol. IUPAC name: methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate. InChIKey: KPCSDMZEMDMWKQ-NTEUORMPSA-N.
| Molecular formula | C28H24ClNO3 |
|---|---|
| Molecular weight | 457.9 g/mol |
| IUPAC name | methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate |
| InChIKey | KPCSDMZEMDMWKQ-NTEUORMPSA-N |
| SMILES | COC(=O)C1=CC=CC=C1CCC(C2=CC=CC(=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)O |
Computed by PubChem (NCBI)