CAS 150026-72-5 appears in our catalog under these names: Montelukast (3R)-Hydroxy Benzoate, Montelukast Impurity 3, 2-(3-(R)-(3-(2-(7-Chloro-2-quinolinyl)ethenyl)phenyl)-3-hydroxypropyl)benzoic Acid Methyl Ester, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
Methyl 2-[(3R)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate (CAS 150026-72-5) is a chemical compound with the molecular formula C28H24ClNO3 and a molecular weight of 457.9 g/mol. IUPAC name: methyl 2-[(3R)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate. InChIKey: KPCSDMZEMDMWKQ-WKMZLRSWSA-N.
| Molecular formula | C28H24ClNO3 |
|---|---|
| Molecular weight | 457.9 g/mol |
| IUPAC name | methyl 2-[(3R)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate |
| InChIKey | KPCSDMZEMDMWKQ-WKMZLRSWSA-N |
| SMILES | COC(=O)C1=CC=CC=C1CC[C@H](C2=CC=CC(=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)O |
Computed by PubChem (NCBI)