CAS 1429903-78-5 appears in our catalog under these names: 2-Chloro-5-(4-fluorophenyl)thiazole-4-carboxylic acid, 95%, 2–Chloro–5–(4–fluorophenyl)thiazole–4–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 250mg, 10g, 5g, 1g.
2-chloro-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 1429903-78-5) is a chemical compound with the molecular formula C10H5ClFNO2S and a molecular weight of 257.67 g/mol. IUPAC name: 2-chloro-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: SWWGPVNCGJCUFJ-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2S |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-chloro-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | SWWGPVNCGJCUFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=C(S2)Cl)C(=O)O)F |
Computed by PubChem (NCBI)