CAS 549526-19-4 is the registry number for 2-(3-Chloro-4-fluorophenyl)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-chloro-4-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 549526-19-4) is a chemical compound with the molecular formula C10H5ClFNO2S and a molecular weight of 257.67 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: KLPGIYQNYUKELG-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2S |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | KLPGIYQNYUKELG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=CS2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)